Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Polydimethylsiloxane, trimethylsiloxy terminated, M.W. 139,000
CAS: 9016-00-6 Molecular Formula: (C2H6OSi)n Molecular Weight (g/mol): 74.15 MDL Number: MFCD00084411 InChI Key: SEUDSDUUJXTXSV-UHFFFAOYSA-N IUPAC Name: dimethylsilanone SMILES: C[Si](C)(-*)O-*
| CAS | 9016-00-6 |
|---|---|
| Molecular Weight (g/mol) | 74.15 |
| MDL Number | MFCD00084411 |
| SMILES | C[Si](C)(-*)O-* |
| IUPAC Name | dimethylsilanone |
| InChI Key | SEUDSDUUJXTXSV-UHFFFAOYSA-N |
| Molecular Formula | (C2H6OSi)n |
2,2'-(Ethylenedioxy)bis(ethylamine), 97+%
CAS: 929-59-9 Molecular Formula: C6H16N2O2 Molecular Weight (g/mol): 148.206 MDL Number: MFCD00040474 InChI Key: IWBOPFCKHIJFMS-UHFFFAOYSA-N Synonym: 1,8-diamino-3,6-dioxaoctane,1,2-bis 2-aminoethoxy ethane,2,2'-ethylenedioxy bis ethylamine,unii-r41zt4uf34,2,2'-ethane-1,2-diylbis oxy diethanamine,3,6-dioxaoctamethylenediamine,2-2-2-aminoethoxy ethoxy ethanamine,3,6-dioxaoctane-1,8-diamine,ethylene glycol bis 2-aminoethyl ether PubChem CID: 70248 IUPAC Name: 2-[2-(2-aminoethoxy)ethoxy]ethanamine SMILES: C(COCCOCCN)N
| PubChem CID | 70248 |
|---|---|
| CAS | 929-59-9 |
| Molecular Weight (g/mol) | 148.206 |
| MDL Number | MFCD00040474 |
| SMILES | C(COCCOCCN)N |
| Synonym | 1,8-diamino-3,6-dioxaoctane,1,2-bis 2-aminoethoxy ethane,2,2'-ethylenedioxy bis ethylamine,unii-r41zt4uf34,2,2'-ethane-1,2-diylbis oxy diethanamine,3,6-dioxaoctamethylenediamine,2-2-2-aminoethoxy ethoxy ethanamine,3,6-dioxaoctane-1,8-diamine,ethylene glycol bis 2-aminoethyl ether |
| IUPAC Name | 2-[2-(2-aminoethoxy)ethoxy]ethanamine |
| InChI Key | IWBOPFCKHIJFMS-UHFFFAOYSA-N |
| Molecular Formula | C6H16N2O2 |
3-Trimethylsilylpropynal, 97%
CAS: 2975-46-4 Molecular Formula: C6H10OSi Molecular Weight (g/mol): 126.23 MDL Number: MFCD01103709 InChI Key: LJRWLSKYGWLYIM-UHFFFAOYSA-N Synonym: 3-trimethylsilylpropynal,3-trimethylsilyl-2-propynal,3-trimethylsilyl propiolaldehyde,3-trimethylsilyl propynal,trimethylsilyl propiolaldehyde,2-propynal, 3-trimethylsilyl,trimethylsilylpropynal,3-trimethylsilyl prop-2-ynal PubChem CID: 2760865 IUPAC Name: 3-trimethylsilylprop-2-ynal SMILES: C[Si](C)(C)C#CC=O
| PubChem CID | 2760865 |
|---|---|
| CAS | 2975-46-4 |
| Molecular Weight (g/mol) | 126.23 |
| MDL Number | MFCD01103709 |
| SMILES | C[Si](C)(C)C#CC=O |
| Synonym | 3-trimethylsilylpropynal,3-trimethylsilyl-2-propynal,3-trimethylsilyl propiolaldehyde,3-trimethylsilyl propynal,trimethylsilyl propiolaldehyde,2-propynal, 3-trimethylsilyl,trimethylsilylpropynal,3-trimethylsilyl prop-2-ynal |
| IUPAC Name | 3-trimethylsilylprop-2-ynal |
| InChI Key | LJRWLSKYGWLYIM-UHFFFAOYSA-N |
| Molecular Formula | C6H10OSi |
5'-O-(4,4'-Dimethoxytrityl)thymidine, 98+%
CAS: 40615-39-2 Molecular Formula: C31H32N2O7 Molecular Weight (g/mol): 544.60 MDL Number: MFCD00010113 InChI Key: UBTJZUKVKGZHAD-QZGLRKMJNA-N Synonym: 5'-o-4,4'-dimethoxytrityl thymidine,dmt-t,thymidine, 5'-o-bis 4-methoxyphenyl phenylmethyl,5'-o-4,4'-dimethoxytrityl thymidine dmt-t,1-2r,4s,5r-5-bis 4-methoxyphenyl-phenylmethoxy methyl-4-hydroxyoxolan-2-yl-5-methylpyrimidine-2,4-dione,5'-o-dimethoxytrityl-deoxythymidine,dmtr-dthd,dimethoxytrityl-t,1-2r,4s,5r-5-bis 4-methoxyphenyl-phenyl-methoxy methyl-4-hydroxy-tetrahydrofuran-2-yl-5-methyl-pyrimidine-2,4-dione PubChem CID: 162419 IUPAC Name: 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione SMILES: COC1=CC=C(C=C1)C(OC[C@H]1O[C@H](C[C@@H]1O)N1C=C(C)C(=O)NC1=O)(C1=CC=CC=C1)C1=CC=C(OC)C=C1
| PubChem CID | 162419 |
|---|---|
| CAS | 40615-39-2 |
| Molecular Weight (g/mol) | 544.60 |
| MDL Number | MFCD00010113 |
| SMILES | COC1=CC=C(C=C1)C(OC[C@H]1O[C@H](C[C@@H]1O)N1C=C(C)C(=O)NC1=O)(C1=CC=CC=C1)C1=CC=C(OC)C=C1 |
| Synonym | 5'-o-4,4'-dimethoxytrityl thymidine,dmt-t,thymidine, 5'-o-bis 4-methoxyphenyl phenylmethyl,5'-o-4,4'-dimethoxytrityl thymidine dmt-t,1-2r,4s,5r-5-bis 4-methoxyphenyl-phenylmethoxy methyl-4-hydroxyoxolan-2-yl-5-methylpyrimidine-2,4-dione,5'-o-dimethoxytrityl-deoxythymidine,dmtr-dthd,dimethoxytrityl-t,1-2r,4s,5r-5-bis 4-methoxyphenyl-phenyl-methoxy methyl-4-hydroxy-tetrahydrofuran-2-yl-5-methyl-pyrimidine-2,4-dione |
| IUPAC Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChI Key | UBTJZUKVKGZHAD-QZGLRKMJNA-N |
| Molecular Formula | C31H32N2O7 |
PTFE rod, 16mm (0.63 in.) dia, Thermo Scientific™
CAS: 9002-84-0 Molecular Formula: (C2F4)n Molecular Weight (g/mol): NaN MDL Number: MFCD00084455 SMILES: FC(F)(-*)C(F)(F)-*
| CAS | 9002-84-0 |
|---|---|
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00084455 |
| SMILES | FC(F)(-*)C(F)(F)-* |
| Molecular Formula | (C2F4)n |
Polyethylene rod, Low Density, 12.7mm (0.5 in.) dia., Thermo Scientific™
CAS: 9002-88-4 Molecular Formula: (C2H4)n Molecular Weight (g/mol): 28.05 MDL Number: MFCD00084423 InChI Key: VGGSQFUCUMXWEO-UHFFFAOYSA-N Synonym: ethylene,acetene,elayl,olefiant gas,athylen,etileno,liquid ethylene,polyethylene,bicarburretted hydrogen,plastipore PubChem CID: 6325 ChEBI: CHEBI:18153 IUPAC Name: ethene SMILES: *-CC-*
| PubChem CID | 6325 |
|---|---|
| CAS | 9002-88-4 |
| Molecular Weight (g/mol) | 28.05 |
| ChEBI | CHEBI:18153 |
| MDL Number | MFCD00084423 |
| SMILES | *-CC-* |
| Synonym | ethylene,acetene,elayl,olefiant gas,athylen,etileno,liquid ethylene,polyethylene,bicarburretted hydrogen,plastipore |
| IUPAC Name | ethene |
| InChI Key | VGGSQFUCUMXWEO-UHFFFAOYSA-N |
| Molecular Formula | (C2H4)n |
Polyethylene rod, High Density, 19mm (0.75 in.) dia. 2.5cm, Thermo Scientific™
CAS: 9002-88-4 Molecular Formula: (C2H4)n Molecular Weight (g/mol): 28.05 MDL Number: MFCD00084423 InChI Key: VGGSQFUCUMXWEO-UHFFFAOYSA-N Synonym: ethylene,acetene,elayl,olefiant gas,athylen,etileno,liquid ethylene,polyethylene,bicarburretted hydrogen,plastipore PubChem CID: 6325 ChEBI: CHEBI:18153 IUPAC Name: ethene SMILES: *-CC-*
| PubChem CID | 6325 |
|---|---|
| CAS | 9002-88-4 |
| Molecular Weight (g/mol) | 28.05 |
| ChEBI | CHEBI:18153 |
| MDL Number | MFCD00084423 |
| SMILES | *-CC-* |
| Synonym | ethylene,acetene,elayl,olefiant gas,athylen,etileno,liquid ethylene,polyethylene,bicarburretted hydrogen,plastipore |
| IUPAC Name | ethene |
| InChI Key | VGGSQFUCUMXWEO-UHFFFAOYSA-N |
| Molecular Formula | (C2H4)n |
Propargylamine hydrochloride, 95%
CAS: 15430-52-1 Molecular Formula: C3H6ClN Molecular Weight (g/mol): 91.54 MDL Number: MFCD00012907 InChI Key: IKXNIQJDNKPPCH-UHFFFAOYSA-N Synonym: propargylamine hydrochloride,prop-2-yn-1-amine hydrochloride,2-propynylamine hydrochloride,propargylamine hcl,2-propynylamine hcl,3-amino-1-propyne hydrochloride,prop-2-ynylamine hydrochloride,2-propyn-1-amine, hydrochloride,pubchem18845,acmc-1bvqh PubChem CID: 11205720 IUPAC Name: prop-2-yn-1-amine;hydrochloride SMILES: [H+].[Cl-].NCC#C
| PubChem CID | 11205720 |
|---|---|
| CAS | 15430-52-1 |
| Molecular Weight (g/mol) | 91.54 |
| MDL Number | MFCD00012907 |
| SMILES | [H+].[Cl-].NCC#C |
| Synonym | propargylamine hydrochloride,prop-2-yn-1-amine hydrochloride,2-propynylamine hydrochloride,propargylamine hcl,2-propynylamine hcl,3-amino-1-propyne hydrochloride,prop-2-ynylamine hydrochloride,2-propyn-1-amine, hydrochloride,pubchem18845,acmc-1bvqh |
| IUPAC Name | prop-2-yn-1-amine;hydrochloride |
| InChI Key | IKXNIQJDNKPPCH-UHFFFAOYSA-N |
| Molecular Formula | C3H6ClN |
3-Phenyl-2-propyn-1-ol, 98+%
CAS: 1504-58-1 Molecular Formula: C9H8O Molecular Weight (g/mol): 132.162 MDL Number: MFCD00040914 InChI Key: NITUNGCLDSFVDL-UHFFFAOYSA-N Synonym: 3-phenyl-2-propyn-1-ol,2-propyn-1-ol, 3-phenyl,3-phenyl-prop-2-yn-1-ol,1-hydroxymethyl-2-phenylacetylene,1-phenyl-1-propyn-3-ol,pubchem13580,3-phenyl-2-propyn1-ol,3-phenylpropargyl alcohol,acmc-1bs1u,1-phenyl-propyn-3-ol PubChem CID: 123115 IUPAC Name: 3-phenylprop-2-yn-1-ol SMILES: C1=CC=C(C=C1)C#CCO
| PubChem CID | 123115 |
|---|---|
| CAS | 1504-58-1 |
| Molecular Weight (g/mol) | 132.162 |
| MDL Number | MFCD00040914 |
| SMILES | C1=CC=C(C=C1)C#CCO |
| Synonym | 3-phenyl-2-propyn-1-ol,2-propyn-1-ol, 3-phenyl,3-phenyl-prop-2-yn-1-ol,1-hydroxymethyl-2-phenylacetylene,1-phenyl-1-propyn-3-ol,pubchem13580,3-phenyl-2-propyn1-ol,3-phenylpropargyl alcohol,acmc-1bs1u,1-phenyl-propyn-3-ol |
| IUPAC Name | 3-phenylprop-2-yn-1-ol |
| InChI Key | NITUNGCLDSFVDL-UHFFFAOYSA-N |
| Molecular Formula | C9H8O |
Ethyl 2-cyanoacetoacetate
CAS: 634-55-9 Molecular Formula: C7H9NO3 Molecular Weight (g/mol): 155.15 MDL Number: MFCD00043487 InChI Key: NWOKVFOTWMZMHL-UHFFFAOYNA-N Synonym: ethyl 2-cyanoacetoacetate,ethyl 2-acetylcyanoacetate,ethyl a-cyanoacetoacetate,ethyl alpha-cyanoacetoacetate,butanoic acid, 2-cyano-3-oxo-, ethyl ester,ethyl2-acetylcyanoacetate,ethyl 2-cyano-3-oxo-butanoate,2-cyanoacetoacetic acid ethyl ester,2-cyano-3-oxo-butyric acid ethyl ester,zlchem 939 PubChem CID: 136455 ChEBI: CHEBI:51924 IUPAC Name: ethyl 2-cyano-3-oxobutanoate SMILES: CCOC(=O)C(C#N)C(C)=O
| PubChem CID | 136455 |
|---|---|
| CAS | 634-55-9 |
| Molecular Weight (g/mol) | 155.15 |
| ChEBI | CHEBI:51924 |
| MDL Number | MFCD00043487 |
| SMILES | CCOC(=O)C(C#N)C(C)=O |
| Synonym | ethyl 2-cyanoacetoacetate,ethyl 2-acetylcyanoacetate,ethyl a-cyanoacetoacetate,ethyl alpha-cyanoacetoacetate,butanoic acid, 2-cyano-3-oxo-, ethyl ester,ethyl2-acetylcyanoacetate,ethyl 2-cyano-3-oxo-butanoate,2-cyanoacetoacetic acid ethyl ester,2-cyano-3-oxo-butyric acid ethyl ester,zlchem 939 |
| IUPAC Name | ethyl 2-cyano-3-oxobutanoate |
| InChI Key | NWOKVFOTWMZMHL-UHFFFAOYNA-N |
| Molecular Formula | C7H9NO3 |
| MDL Number | MFCD00144065 |
|---|---|
| Packaging | Shrink-wrapped |
| Chemical Name or Material | Graphite plate |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| EINECS Number | 231-955-3 |
Platinum, 5% on activated carbon powder, sulfided, 0.5% S (as sulfide)
CAS: 6-6-7440 MDL Number: MFCD00011179
| CAS | 6-6-7440 |
|---|---|
| MDL Number | MFCD00011179 |
Polyethylene, UHMW
CAS: 9002-88-4 Molecular Formula: (C2H4)n Molecular Weight (g/mol): 28.05 MDL Number: MFCD00084423 InChI Key: VGGSQFUCUMXWEO-UHFFFAOYSA-N Synonym: ethylene,acetene,elayl,olefiant gas,athylen,etileno,liquid ethylene,polyethylene,bicarburretted hydrogen,plastipore PubChem CID: 6325 ChEBI: CHEBI:18153 IUPAC Name: ethene SMILES: *-CC-*
| PubChem CID | 6325 |
|---|---|
| CAS | 9002-88-4 |
| Molecular Weight (g/mol) | 28.05 |
| ChEBI | CHEBI:18153 |
| MDL Number | MFCD00084423 |
| SMILES | *-CC-* |
| Synonym | ethylene,acetene,elayl,olefiant gas,athylen,etileno,liquid ethylene,polyethylene,bicarburretted hydrogen,plastipore |
| IUPAC Name | ethene |
| InChI Key | VGGSQFUCUMXWEO-UHFFFAOYSA-N |
| Molecular Formula | (C2H4)n |
Lithium methoxide, 98+%
CAS: 865-34-9 Molecular Formula: CH3LiO Molecular Weight (g/mol): 37.97 MDL Number: MFCD00036357 InChI Key: JILPJDVXYVTZDQ-UHFFFAOYSA-N Synonym: lithium methoxide,lithium methanolate,methanol, lithium salt,lithium methylate,liome,methanol, lithium salt 1:1,liom,lithium methylat,lithotab methoxide,lioch3 PubChem CID: 4177230 SMILES: [Li+].C[O-]
| PubChem CID | 4177230 |
|---|---|
| CAS | 865-34-9 |
| Molecular Weight (g/mol) | 37.97 |
| MDL Number | MFCD00036357 |
| SMILES | [Li+].C[O-] |
| Synonym | lithium methoxide,lithium methanolate,methanol, lithium salt,lithium methylate,liome,methanol, lithium salt 1:1,liom,lithium methylat,lithotab methoxide,lioch3 |
| InChI Key | JILPJDVXYVTZDQ-UHFFFAOYSA-N |
| Molecular Formula | CH3LiO |
Ferroceneacetonitrile, 97%, Thermo Scientific™
CAS: 1316-91-2 Molecular Formula: C12H11FeN Molecular Weight (g/mol): 225.07 MDL Number: MFCD00068572 IUPAC Name: Ferroceneacetonitrile SMILES: [Fe].c1cccc1.N#CCc1cccc1
| CAS | 1316-91-2 |
|---|---|
| Molecular Weight (g/mol) | 225.07 |
| MDL Number | MFCD00068572 |
| SMILES | [Fe].c1cccc1.N#CCc1cccc1 |
| IUPAC Name | Ferroceneacetonitrile |
| Molecular Formula | C12H11FeN |